Products 2248406-62-2

CAS 2248406-62-2 is the registry number for 2-(3-Methoxy-2,2-dimethylcyclobutyl)acetic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2-(3-methoxy-2,2-dimethylcyclobutyl)acetic acid (CAS 2248406-62-2) is a chemical compound with the molecular formula C9H16O3 and a molecular weight of 172.22 g/mol. IUPAC name: 2-(3-methoxy-2,2-dimethylcyclobutyl)acetic acid. InChIKey: JIXJVFKLFUWCIU-UHFFFAOYSA-N.

Identity
Molecular formulaC9H16O3
Molecular weight172.22 g/mol
IUPAC name2-(3-methoxy-2,2-dimethylcyclobutyl)acetic acid
InChIKeyJIXJVFKLFUWCIU-UHFFFAOYSA-N
SMILESCC1(C(CC1OC)CC(=O)O)C

Computed by PubChem (NCBI)