CAS 2248620-16-6 appears in our catalog under these names: Potassium trifluoro(4-(trifluoromethyl)benzyl)borate, 97%, 97%, Potassium trifluoro({[4-(trifluoromethyl)phenyl]methyl})boranuide, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 500mg, 1g.
Potassium trifluoro-[[4-(trifluoromethyl)phenyl]methyl]boranuide (CAS 2248620-16-6) is a chemical compound with the molecular formula C8H6BF6K and a molecular weight of 266.03 g/mol. IUPAC name: potassium trifluoro-[[4-(trifluoromethyl)phenyl]methyl]boranuide. InChIKey: AVARCLDDIUKYLJ-UHFFFAOYSA-N.
| Molecular formula | C8H6BF6K |
|---|---|
| Molecular weight | 266.03 g/mol |
| IUPAC name | potassium trifluoro-[[4-(trifluoromethyl)phenyl]methyl]boranuide |
| InChIKey | AVARCLDDIUKYLJ-UHFFFAOYSA-N |
| SMILES | [B-](CC1=CC=C(C=C1)C(F)(F)F)(F)(F)F.[K+] |
Computed by PubChem (NCBI)