CAS 2248702-80-7 appears in our catalog under these names: TDP1 Inhibitor-1, 99%, TDP1 Inhibitor–1, 2,3-Dimethoxy-13-(2-(pyrrolidin-1-yl)ethoxy)-[1,3]dioxolo[4',5':4,5]benzo[1,2-c]phenanthridine, 99.81%, 99.81%, TDP1 Inhibitor-1, 98.33%. Offered by: AmBeed, GLPBio, Chemat, MedChemExpress. Available pack sizes: 100mg, 1mg, 10mg, 5mg, 5 mg, 100 mg, 25 mg, 10 mg.
2,3-dimethoxy-13-(2-pyrrolidin-1-ylethoxy)-[1,3]benzodioxolo[5,6-c]phenanthridine (CAS 2248702-80-7) is a chemical compound with the molecular formula C26H26N2O5 and a molecular weight of 446.5 g/mol. IUPAC name: 2,3-dimethoxy-13-(2-pyrrolidin-1-ylethoxy)-[1,3]benzodioxolo[5,6-c]phenanthridine. InChIKey: AXNFOXAWCCNLFG-UHFFFAOYSA-N.
| Molecular formula | C26H26N2O5 |
|---|---|
| Molecular weight | 446.5 g/mol |
| IUPAC name | 2,3-dimethoxy-13-(2-pyrrolidin-1-ylethoxy)-[1,3]benzodioxolo[5,6-c]phenanthridine |
| InChIKey | AXNFOXAWCCNLFG-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C3=C(C4=CC5=C(C=C4C=C3)OCO5)N=C2OCCN6CCCC6)OC |
Computed by PubChem (NCBI)