CAS 2249724-54-5 is the registry number for rac-1-{((1R,2S)-1-Methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)sulfanyl}ethan-1-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
S-[(1S,2R)-1-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl] ethanethioate (CAS 2249724-54-5) is a chemical compound with the molecular formula C13H16O2S and a molecular weight of 236.33 g/mol. IUPAC name: S-[(1S,2R)-1-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl] ethanethioate. InChIKey: CKLXYQAKVRYTKG-OLZOCXBDSA-N.
| Molecular formula | C13H16O2S |
|---|---|
| Molecular weight | 236.33 g/mol |
| IUPAC name | S-[(1S,2R)-1-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl] ethanethioate |
| InChIKey | CKLXYQAKVRYTKG-OLZOCXBDSA-N |
| SMILES | CC(=O)S[C@@H]1CCC2=CC=CC=C2[C@@H]1OC |
Computed by PubChem (NCBI)