CAS 2250024-95-2 appears in our catalog under these names: Methyl 1-(3-amino-4-(4-methylpiperazin-1-yl)phenyl)-1H-1,2,3-triazole-4-carboxylate, 95%, 95%, Methyl 1-(3-amino-4-(4-methylpiperazin-1-yl)phenyl)-1H-1,2,3-triazole-4-carboxylate, 95%. Offered by: Chemat, AmBeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
Methyl 1-[3-amino-4-(4-methylpiperazin-1-yl)phenyl]triazole-4-carboxylate (CAS 2250024-95-2) is a chemical compound with the molecular formula C15H20N6O2 and a molecular weight of 316.36 g/mol. IUPAC name: methyl 1-[3-amino-4-(4-methylpiperazin-1-yl)phenyl]triazole-4-carboxylate. InChIKey: MJYBYXZQUPJBHB-UHFFFAOYSA-N.
| Molecular formula | C15H20N6O2 |
|---|---|
| Molecular weight | 316.36 g/mol |
| IUPAC name | methyl 1-[3-amino-4-(4-methylpiperazin-1-yl)phenyl]triazole-4-carboxylate |
| InChIKey | MJYBYXZQUPJBHB-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=C(C=C(C=C2)N3C=C(N=N3)C(=O)OC)N |
Computed by PubChem (NCBI)