Products 2250027-06-4
CAS 2250027-06-4 is the registry number for Alloc-L-Pro(4-NH-Fmoc)-OH (2S,4R). Offered by: Iris Biotech. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 500mg, 1g, 5g.
(2S,4R)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-1-prop-2-enoxycarbonylpyrrolidine-2-carboxylic acid (CAS 2250027-06-4) is a chemical compound with the molecular formula C24H24N2O6 and a molecular weight of 436.5 g/mol. IUPAC name: (2S,4R)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-1-prop-2-enoxycarbonylpyrrolidine-2-carboxylic acid. InChIKey: IKAPJKQKVHYVSL-VFNWGFHPSA-N.
| Molecular formula | C24H24N2O6 |
|---|---|
| Molecular weight | 436.5 g/mol |
| IUPAC name | (2S,4R)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-1-prop-2-enoxycarbonylpyrrolidine-2-carboxylic acid |
| InChIKey | IKAPJKQKVHYVSL-VFNWGFHPSA-N |
| SMILES | C=CCOC(=O)N1C[C@@H](C[C@H]1C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)