CAS 2250142-71-1 is the registry number for Nicorandil Impurity 13. Offered by: Chemat Brand. Available pack sizes: on request.
2-[[1-[2-(pyridine-3-carbonylamino)ethyl]pyridin-1-ium-3-carbonyl]amino]ethyl nitrate iodide (CAS 2250142-71-1) is a chemical compound with the molecular formula C16H18IN5O5 and a molecular weight of 487.25 g/mol. IUPAC name: 2-[[1-[2-(pyridine-3-carbonylamino)ethyl]pyridin-1-ium-3-carbonyl]amino]ethyl nitrate iodide. InChIKey: IYHWSHLPPAWUFZ-UHFFFAOYSA-N.
| Molecular formula | C16H18IN5O5 |
|---|---|
| Molecular weight | 487.25 g/mol |
| IUPAC name | 2-[[1-[2-(pyridine-3-carbonylamino)ethyl]pyridin-1-ium-3-carbonyl]amino]ethyl nitrate iodide |
| InChIKey | IYHWSHLPPAWUFZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C(=O)NCC[N+]2=CC=CC(=C2)C(=O)NCCO[N+](=O)[O-].[I-] |
Computed by PubChem (NCBI)