CAS 2250240-87-8 appears in our catalog under these names: (3R,4S)-3-((S)-3-(4-Fluorophenyl)-3-hydroxypropyl)-1,4-diphenylazetidin-2-one, 95%, Ezetimibe Impurity 72. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(3R,4S)-3-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-1,4-diphenylazetidin-2-one (CAS 2250240-87-8) is a chemical compound with the molecular formula C24H22FNO2 and a molecular weight of 375.4 g/mol. IUPAC name: (3R,4S)-3-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-1,4-diphenylazetidin-2-one. InChIKey: MGLJQYMFBDTFTE-XPWALMASSA-N.
| Molecular formula | C24H22FNO2 |
|---|---|
| Molecular weight | 375.4 g/mol |
| IUPAC name | (3R,4S)-3-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-1,4-diphenylazetidin-2-one |
| InChIKey | MGLJQYMFBDTFTE-XPWALMASSA-N |
| SMILES | C1=CC=C(C=C1)[C@@H]2[C@H](C(=O)N2C3=CC=CC=C3)CC[C@@H](C4=CC=C(C=C4)F)O |
Computed by PubChem (NCBI)