CAS 2250242-56-7 appears in our catalog under these names: Lenvatinib Impurity 1, Lenvatinib Impurity N, Lenvatinib Impurity 12, 4-(4-Amino-3-(4-amino-3-chlorophenoxy)phenoxy) Lenvatinib. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
4-[4-amino-3-(4-amino-3-chlorophenoxy)phenoxy]-7-methoxyquinoline-6-carboxamide (CAS 2250242-56-7) is a chemical compound with the molecular formula C23H19ClN4O4 and a molecular weight of 450.9 g/mol. IUPAC name: 4-[4-amino-3-(4-amino-3-chlorophenoxy)phenoxy]-7-methoxyquinoline-6-carboxamide. InChIKey: UAAFZTOERVSZRQ-UHFFFAOYSA-N.
| Molecular formula | C23H19ClN4O4 |
|---|---|
| Molecular weight | 450.9 g/mol |
| IUPAC name | 4-[4-amino-3-(4-amino-3-chlorophenoxy)phenoxy]-7-methoxyquinoline-6-carboxamide |
| InChIKey | UAAFZTOERVSZRQ-UHFFFAOYSA-N |
| SMILES | COC1=CC2=NC=CC(=C2C=C1C(=O)N)OC3=CC(=C(C=C3)N)OC4=CC(=C(C=C4)N)Cl |
Computed by PubChem (NCBI)