CAS 2250288-89-0 is the registry number for Hydrouracil-4-benzazimide-7-NH2. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-(7-amino-4-oxo-1,2,3-benzotriazin-3-yl)piperidine-2,6-dione (CAS 2250288-89-0) is a chemical compound with the molecular formula C12H11N5O3 and a molecular weight of 273.25 g/mol. IUPAC name: 3-(7-amino-4-oxo-1,2,3-benzotriazin-3-yl)piperidine-2,6-dione. InChIKey: SPBMEUGIUHPHER-UHFFFAOYSA-N.
| Molecular formula | C12H11N5O3 |
|---|---|
| Molecular weight | 273.25 g/mol |
| IUPAC name | 3-(7-amino-4-oxo-1,2,3-benzotriazin-3-yl)piperidine-2,6-dione |
| InChIKey | SPBMEUGIUHPHER-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C=C(C=C3)N)N=N2 |
Computed by PubChem (NCBI)