Products 2250340-35-1
CAS 2250340-35-1 is the registry number for 6-Amino-4-bromo-3-chloro-2-fluorobenzamide, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
6-amino-4-bromo-3-chloro-2-fluorobenzamide (CAS 2250340-35-1) is a chemical compound with the molecular formula C7H5BrClFN2O and a molecular weight of 267.48 g/mol. IUPAC name: 6-amino-4-bromo-3-chloro-2-fluorobenzamide. InChIKey: XKYUOMGDAJGTSV-UHFFFAOYSA-N.
| Molecular formula | C7H5BrClFN2O |
|---|---|
| Molecular weight | 267.48 g/mol |
| IUPAC name | 6-amino-4-bromo-3-chloro-2-fluorobenzamide |
| InChIKey | XKYUOMGDAJGTSV-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)Cl)F)C(=O)N)N |
Computed by PubChem (NCBI)