CAS 2230875-08-6 is the registry number for 2-Amino-4-bromo-5-chloro-3-fluorobenzamide, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2-amino-4-bromo-5-chloro-3-fluorobenzamide (CAS 2230875-08-6) is a chemical compound with the molecular formula C7H5BrClFN2O and a molecular weight of 267.48 g/mol. IUPAC name: 2-amino-4-bromo-5-chloro-3-fluorobenzamide. InChIKey: WMBMUHULNCPFGB-UHFFFAOYSA-N.
| Molecular formula | C7H5BrClFN2O |
|---|---|
| Molecular weight | 267.48 g/mol |
| IUPAC name | 2-amino-4-bromo-5-chloro-3-fluorobenzamide |
| InChIKey | WMBMUHULNCPFGB-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Cl)Br)F)N)C(=O)N |
Computed by PubChem (NCBI)