CAS 22504-83-2 appears in our catalog under these names: 2-(4-Methylphenoxy)propanoic acid, 95%, 2-(4-METHYLPHENOXY)PROPIONIC ACID, 97%, 2-(p-Tolyloxy)propanoic acid, 96%, 96%. Offered by: Combi-blocks, Fluorochem, Chemat. Available pack sizes: 250mg, 5g, 1g, 25g, 100mg.
2-(4-methylphenoxy)propanoic acid (CAS 22504-83-2) is a chemical compound with the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. IUPAC name: 2-(4-methylphenoxy)propanoic acid. InChIKey: BTQZPXFENISXER-UHFFFAOYSA-N.
| Molecular formula | C10H12O3 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | 2-(4-methylphenoxy)propanoic acid |
| InChIKey | BTQZPXFENISXER-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)OC(C)C(=O)O |
Computed by PubChem (NCBI)