Products 2251053-46-8

CAS 2251053-46-8 is the registry number for 2-[1-(3-Chlorophenyl)-4,4-difluorocyclohexyl]acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 25mg.

Structural formula: {0} (CAS {1})

2-[1-(3-chlorophenyl)-4,4-difluorocyclohexyl]acetic acid (CAS 2251053-46-8) is a chemical compound with the molecular formula C14H15ClF2O2 and a molecular weight of 288.72 g/mol. IUPAC name: 2-[1-(3-chlorophenyl)-4,4-difluorocyclohexyl]acetic acid. InChIKey: YMGTUJHVGHFVAZ-UHFFFAOYSA-N.

Identity
Molecular formulaC14H15ClF2O2
Molecular weight288.72 g/mol
IUPAC name2-[1-(3-chlorophenyl)-4,4-difluorocyclohexyl]acetic acid
InChIKeyYMGTUJHVGHFVAZ-UHFFFAOYSA-N
SMILESC1CC(CCC1(CC(=O)O)C2=CC(=CC=C2)Cl)(F)F

Computed by PubChem (NCBI)