CAS 2251053-51-5 is the registry number for 5-Bromo-2-(pyridin-4-yl)-2,3-dihydropyridazin-3-one, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 250mg.
5-bromo-2-pyridin-4-ylpyridazin-3-one (CAS 2251053-51-5) is a chemical compound with the molecular formula C9H6BrN3O and a molecular weight of 252.07 g/mol. IUPAC name: 5-bromo-2-pyridin-4-ylpyridazin-3-one. InChIKey: LIZKABDILSMJEM-UHFFFAOYSA-N.
| Molecular formula | C9H6BrN3O |
|---|---|
| Molecular weight | 252.07 g/mol |
| IUPAC name | 5-bromo-2-pyridin-4-ylpyridazin-3-one |
| InChIKey | LIZKABDILSMJEM-UHFFFAOYSA-N |
| SMILES | C1=CN=CC=C1N2C(=O)C=C(C=N2)Br |
Computed by PubChem (NCBI)