CAS 2251054-10-9 is the registry number for 2-[5-(Aminomethyl)pyridin-2-yl]-1,2- thiazinane-1,1-dione dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg.
[6-(1,1-dioxothiazinan-2-yl)-3-pyridinyl]methanamine;dihydrochloride (CAS 2251054-10-9) is a chemical compound with the molecular formula C10H17Cl2N3O2S and a molecular weight of 314.2 g/mol. IUPAC name: [6-(1,1-dioxothiazinan-2-yl)-3-pyridinyl]methanamine;dihydrochloride. InChIKey: QFCXCNPMQYIGNY-UHFFFAOYSA-N.
| Molecular formula | C10H17Cl2N3O2S |
|---|---|
| Molecular weight | 314.2 g/mol |
| IUPAC name | [6-(1,1-dioxothiazinan-2-yl)-3-pyridinyl]methanamine;dihydrochloride |
| InChIKey | QFCXCNPMQYIGNY-UHFFFAOYSA-N |
| SMILES | C1CCS(=O)(=O)N(C1)C2=NC=C(C=C2)CN.Cl.Cl |
Computed by PubChem (NCBI)