CAS 2251727-90-7 is the registry number for URAT1 inhibitor 9. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[3-(4-cyanonaphthalen-1-yl)-4-pyridinyl]thiophene-2-sulfonamide (CAS 2251727-90-7) is a chemical compound with the molecular formula C20H13N3O2S2 and a molecular weight of 391.5 g/mol. IUPAC name: N-[3-(4-cyanonaphthalen-1-yl)-4-pyridinyl]thiophene-2-sulfonamide. InChIKey: UUBWGZUKKBPUTK-UHFFFAOYSA-N.
| Molecular formula | C20H13N3O2S2 |
|---|---|
| Molecular weight | 391.5 g/mol |
| IUPAC name | N-[3-(4-cyanonaphthalen-1-yl)-4-pyridinyl]thiophene-2-sulfonamide |
| InChIKey | UUBWGZUKKBPUTK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=C2C3=C(C=CN=C3)NS(=O)(=O)C4=CC=CS4)C#N |
Computed by PubChem (NCBI)