CAS 2251781-83-4 is the registry number for 5-Methyl-5H-dibenzo[b,d]thiophen-5-ium trifluoromethanesulfonate-d3, 98.0%. Offered by: MedChemExpress. Available pack sizes: 100 mg, 250 mg.
5-(trideuteriomethyl)dibenzothiophen-5-ium;trifluoromethanesulfonate (CAS 2251781-83-4) is a chemical compound with the molecular formula C14H11F3O3S2 and a molecular weight of 351.4 g/mol. IUPAC name: 5-(trideuteriomethyl)dibenzothiophen-5-ium;trifluoromethanesulfonate. InChIKey: ROHWBLNJJVPWCN-NIIDSAIPSA-M.
| Molecular formula | C14H11F3O3S2 |
|---|---|
| Molecular weight | 351.4 g/mol |
| IUPAC name | 5-(trideuteriomethyl)dibenzothiophen-5-ium;trifluoromethanesulfonate |
| InChIKey | ROHWBLNJJVPWCN-NIIDSAIPSA-M |
| SMILES | [2H]C([2H])([2H])[S+]1C2=CC=CC=C2C3=CC=CC=C31.C(F)(F)(F)S(=O)(=O)[O-] |
Computed by PubChem (NCBI)