Products 22518-08-7
CAS 22518-08-7 appears in our catalog under these names: 8–Hydroxy–9，10–diisobutyryloxythymol, 8-Hydroxy-9,10-diisobutyryloxythymol. Offered by: GLPBio, MedChemExpress. Available pack sizes: 5mg, Get quote.
[2-hydroxy-2-(2-hydroxy-4-methylphenyl)-3-(2-methylpropanoyloxy)propyl] 2-methylpropanoate (CAS 22518-08-7) is a chemical compound with the molecular formula C18H26O6 and a molecular weight of 338.4 g/mol. IUPAC name: [2-hydroxy-2-(2-hydroxy-4-methylphenyl)-3-(2-methylpropanoyloxy)propyl] 2-methylpropanoate. InChIKey: OQYPKKAXTUWISE-UHFFFAOYSA-N.
| Molecular formula | C18H26O6 |
|---|---|
| Molecular weight | 338.4 g/mol |
| IUPAC name | [2-hydroxy-2-(2-hydroxy-4-methylphenyl)-3-(2-methylpropanoyloxy)propyl] 2-methylpropanoate |
| InChIKey | OQYPKKAXTUWISE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C(COC(=O)C(C)C)(COC(=O)C(C)C)O)O |
Computed by PubChem (NCBI)