Products 2252151-12-3
CAS 2252151-12-3 is the registry number for methyl 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-benzofuran-2-carboxylate, 97%. Offered by: Chemat. Available pack sizes: 100mg.
Methyl 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-benzofuran-2-carboxylate (CAS 2252151-12-3) is a chemical compound with the molecular formula C16H19BO5 and a molecular weight of 302.1 g/mol. IUPAC name: methyl 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-benzofuran-2-carboxylate. InChIKey: PHKNSIQJKRTXLF-UHFFFAOYSA-N.
| Molecular formula | C16H19BO5 |
|---|---|
| Molecular weight | 302.1 g/mol |
| IUPAC name | methyl 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-benzofuran-2-carboxylate |
| InChIKey | PHKNSIQJKRTXLF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)C=C(O3)C(=O)OC |
Computed by PubChem (NCBI)