CAS 2252239-09-9 is the registry number for 8-Chloroperfluorooctylphosphonic Acid. Offered by: TRC. Available pack sizes: 100mg.
(8-chloro-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluorooctyl)phosphonic acid (CAS 2252239-09-9) is a chemical compound with the molecular formula C8H2ClF16O3P and a molecular weight of 516.50 g/mol. IUPAC name: (8-chloro-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluorooctyl)phosphonic acid. InChIKey: JTUDXWNBUPNSAX-UHFFFAOYSA-N.
| Molecular formula | C8H2ClF16O3P |
|---|---|
| Molecular weight | 516.50 g/mol |
| IUPAC name | (8-chloro-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluorooctyl)phosphonic acid |
| InChIKey | JTUDXWNBUPNSAX-UHFFFAOYSA-N |
| SMILES | C(C(C(C(C(F)(F)Cl)(F)F)(F)F)(F)F)(C(C(C(F)(F)P(=O)(O)O)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)