Products 2252336-04-0
CAS 2252336-04-0 is the registry number for AMPK activator 16. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-chloro-N-[4-[(E)-3-(2,5-dimethoxyphenyl)prop-2-enoyl]phenyl]benzenesulfonamide (CAS 2252336-04-0) is a chemical compound with the molecular formula C23H20ClNO5S and a molecular weight of 457.9 g/mol. IUPAC name: 4-chloro-N-[4-[(E)-3-(2,5-dimethoxyphenyl)prop-2-enoyl]phenyl]benzenesulfonamide. InChIKey: MPNVVXGQFYTNEK-WLRTZDKTSA-N.
| Molecular formula | C23H20ClNO5S |
|---|---|
| Molecular weight | 457.9 g/mol |
| IUPAC name | 4-chloro-N-[4-[(E)-3-(2,5-dimethoxyphenyl)prop-2-enoyl]phenyl]benzenesulfonamide |
| InChIKey | MPNVVXGQFYTNEK-WLRTZDKTSA-N |
| SMILES | COC1=CC(=C(C=C1)OC)/C=C/C(=O)C2=CC=C(C=C2)NS(=O)(=O)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)
Synonyms:
AMPK activator 16, orb2944895