CAS 2252493-33-5 appears in our catalog under these names: (R)–ND–336, (R)-ND-336. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, Get quote.
[4-[4-[[(2R)-thiiran-2-yl]methylsulfonyl]phenoxy]phenyl]methanamine;hydrochloride (CAS 2252493-33-5) is a chemical compound with the molecular formula C16H18ClNO3S2 and a molecular weight of 371.9 g/mol. IUPAC name: [4-[4-[[(2R)-thiiran-2-yl]methylsulfonyl]phenoxy]phenyl]methanamine;hydrochloride. InChIKey: DRGIZFGSEKSFIC-XFULWGLBSA-N.
| Molecular formula | C16H18ClNO3S2 |
|---|---|
| Molecular weight | 371.9 g/mol |
| IUPAC name | [4-[4-[[(2R)-thiiran-2-yl]methylsulfonyl]phenoxy]phenyl]methanamine;hydrochloride |
| InChIKey | DRGIZFGSEKSFIC-XFULWGLBSA-N |
| SMILES | C1[C@@H](S1)CS(=O)(=O)C2=CC=C(C=C2)OC3=CC=C(C=C3)CN.Cl |
Computed by PubChem (NCBI)