CAS 22525-53-7 is the registry number for (1-(azaphenylmethylene)inden-3-yl)phenylamine, hydrochloride. Offered by: Biosynth. Available pack sizes: 250mg.
N-phenyl-3-phenyliminoinden-1-amine;hydrochloride (CAS 22525-53-7) is a chemical compound with the molecular formula C21H17ClN2 and a molecular weight of 332.8 g/mol. IUPAC name: N-phenyl-3-phenyliminoinden-1-amine;hydrochloride. InChIKey: QOFIFACMXGPUGI-UHFFFAOYSA-N.
| Molecular formula | C21H17ClN2 |
|---|---|
| Molecular weight | 332.8 g/mol |
| IUPAC name | N-phenyl-3-phenyliminoinden-1-amine;hydrochloride |
| InChIKey | QOFIFACMXGPUGI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=CC(=NC3=CC=CC=C3)C4=CC=CC=C42.Cl |
Computed by PubChem (NCBI)