Products 2253175-64-1
CAS 2253175-64-1 is the registry number for CRS400393. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-(5,7-dichloro-1,3-benzothiazol-2-yl)-5-methylbicyclo[3.3.1]nonane-1-carboxamide (CAS 2253175-64-1) is a chemical compound with the molecular formula C18H20Cl2N2OS and a molecular weight of 383.3 g/mol. IUPAC name: N-(5,7-dichloro-1,3-benzothiazol-2-yl)-5-methylbicyclo[3.3.1]nonane-1-carboxamide. InChIKey: KHJLLQYNCQNVKV-UHFFFAOYSA-N.
| Molecular formula | C18H20Cl2N2OS |
|---|---|
| Molecular weight | 383.3 g/mol |
| IUPAC name | N-(5,7-dichloro-1,3-benzothiazol-2-yl)-5-methylbicyclo[3.3.1]nonane-1-carboxamide |
| InChIKey | KHJLLQYNCQNVKV-UHFFFAOYSA-N |
| SMILES | CC12CCCC(C1)(CCC2)C(=O)NC3=NC4=C(S3)C(=CC(=C4)Cl)Cl |
Computed by PubChem (NCBI)