Products 2253619-58-6
CAS 2253619-58-6 is the registry number for (1R)-1-(1-(Azetidin-3-yl)-1H-1,2,3-triazol-4-yl)ethan-1-ol hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(1R)-1-[1-(azetidin-3-yl)triazol-4-yl]ethanol;hydrochloride (CAS 2253619-58-6) is a chemical compound with the molecular formula C7H13ClN4O and a molecular weight of 204.66 g/mol. IUPAC name: (1R)-1-[1-(azetidin-3-yl)triazol-4-yl]ethanol;hydrochloride. InChIKey: FGGDYKGCSPFIFJ-NUBCRITNSA-N.
| Molecular formula | C7H13ClN4O |
|---|---|
| Molecular weight | 204.66 g/mol |
| IUPAC name | (1R)-1-[1-(azetidin-3-yl)triazol-4-yl]ethanol;hydrochloride |
| InChIKey | FGGDYKGCSPFIFJ-NUBCRITNSA-N |
| SMILES | C[C@H](C1=CN(N=N1)C2CNC2)O.Cl |
Computed by PubChem (NCBI)