CAS 2253619-67-7 is the registry number for (1S)-1-(5-(Aminomethyl)-1H-1,2,4-triazol-3-yl)ethan-1-ol hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(1S)-1-[5-(aminomethyl)-1H-1,2,4-triazol-3-yl]ethanol;hydrochloride (CAS 2253619-67-7) is a chemical compound with the molecular formula C5H11ClN4O and a molecular weight of 178.62 g/mol. IUPAC name: (1S)-1-[5-(aminomethyl)-1H-1,2,4-triazol-3-yl]ethanol;hydrochloride. InChIKey: SMFUMCBTPYMACG-DFWYDOINSA-N.
| Molecular formula | C5H11ClN4O |
|---|---|
| Molecular weight | 178.62 g/mol |
| IUPAC name | (1S)-1-[5-(aminomethyl)-1H-1,2,4-triazol-3-yl]ethanol;hydrochloride |
| InChIKey | SMFUMCBTPYMACG-DFWYDOINSA-N |
| SMILES | C[C@@H](C1=NNC(=N1)CN)O.Cl |
Computed by PubChem (NCBI)