CAS 2253629-78-4 is the registry number for 3-Chloro-2,5-difluoroaniline hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
3-chloro-2,5-difluoroaniline;hydrochloride (CAS 2253629-78-4) is a chemical compound with the molecular formula C6H5Cl2F2N and a molecular weight of 200.01 g/mol. IUPAC name: 3-chloro-2,5-difluoroaniline;hydrochloride. InChIKey: CZHRHKHKOCYJBQ-UHFFFAOYSA-N.
| Molecular formula | C6H5Cl2F2N |
|---|---|
| Molecular weight | 200.01 g/mol |
| IUPAC name | 3-chloro-2,5-difluoroaniline;hydrochloride |
| InChIKey | CZHRHKHKOCYJBQ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1N)F)Cl)F.Cl |
Computed by PubChem (NCBI)