CAS 2253632-01-6 is the registry number for N-Hydroxypipecolic acid (potassium). Offered by: MedChemExpress. Available pack sizes: 5mg, 25mg, 10mg.
Potassium 1-hydroxypiperidine-2-carboxylate (CAS 2253632-01-6) is a chemical compound with the molecular formula C6H10KNO3 and a molecular weight of 183.25 g/mol. IUPAC name: potassium 1-hydroxypiperidine-2-carboxylate. InChIKey: BKTXYYHZOUDDDJ-UHFFFAOYSA-M.
| Molecular formula | C6H10KNO3 |
|---|---|
| Molecular weight | 183.25 g/mol |
| IUPAC name | potassium 1-hydroxypiperidine-2-carboxylate |
| InChIKey | BKTXYYHZOUDDDJ-UHFFFAOYSA-M |
| SMILES | C1CCN(C(C1)C(=O)[O-])O.[K+] |
Computed by PubChem (NCBI)