Products 2253638-89-8
CAS 2253638-89-8 is the registry number for 4,4-Dimethyl-1-oxa-3,7-diazaspiro(4.4)nonan-2-one hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4,4-dimethyl-1-oxa-3,7-diazaspiro[4.4]nonan-2-one;hydrochloride (CAS 2253638-89-8) is a chemical compound with the molecular formula C8H15ClN2O2 and a molecular weight of 206.67 g/mol. IUPAC name: 4,4-dimethyl-1-oxa-3,7-diazaspiro[4.4]nonan-2-one;hydrochloride. InChIKey: DHGWUKKQGQMEMC-UHFFFAOYSA-N.
| Molecular formula | C8H15ClN2O2 |
|---|---|
| Molecular weight | 206.67 g/mol |
| IUPAC name | 4,4-dimethyl-1-oxa-3,7-diazaspiro[4.4]nonan-2-one;hydrochloride |
| InChIKey | DHGWUKKQGQMEMC-UHFFFAOYSA-N |
| SMILES | CC1(C2(CCNC2)OC(=O)N1)C.Cl |
Computed by PubChem (NCBI)