Products 2253639-55-1
CAS 2253639-55-1 is the registry number for tert-Butyl 3,3,5-trimethyl-4-oxopiperidine-1-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Tert-butyl 3,3,5-trimethyl-4-oxopiperidine-1-carboxylate (CAS 2253639-55-1) is a chemical compound with the molecular formula C13H23NO3 and a molecular weight of 241.33 g/mol. IUPAC name: tert-butyl 3,3,5-trimethyl-4-oxopiperidine-1-carboxylate. InChIKey: LVBHAAHGHWVBFY-UHFFFAOYSA-N.
| Molecular formula | C13H23NO3 |
|---|---|
| Molecular weight | 241.33 g/mol |
| IUPAC name | tert-butyl 3,3,5-trimethyl-4-oxopiperidine-1-carboxylate |
| InChIKey | LVBHAAHGHWVBFY-UHFFFAOYSA-N |
| SMILES | CC1CN(CC(C1=O)(C)C)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)