CAS 2253641-26-6 is the registry number for rac-((1R,3S)-3-(Fluoromethyl)cyclohexyl)methanamine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
[(1R,3S)-3-(fluoromethyl)cyclohexyl]methanamine;hydrochloride (CAS 2253641-26-6) is a chemical compound with the molecular formula C8H17ClFN and a molecular weight of 181.68 g/mol. IUPAC name: [(1R,3S)-3-(fluoromethyl)cyclohexyl]methanamine;hydrochloride. InChIKey: VNASSTVNLRLXRF-KZYPOYLOSA-N.
| Molecular formula | C8H17ClFN |
|---|---|
| Molecular weight | 181.68 g/mol |
| IUPAC name | [(1R,3S)-3-(fluoromethyl)cyclohexyl]methanamine;hydrochloride |
| InChIKey | VNASSTVNLRLXRF-KZYPOYLOSA-N |
| SMILES | C1C[C@H](C[C@H](C1)CF)CN.Cl |
Computed by PubChem (NCBI)