Products 2253686-94-9
CAS 2253686-94-9 is the registry number for Cdc7-IN-17. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[(1S)-1-amino-2-methylpropyl]-6-(1H-pyrazol-5-yl)-3H-thieno[3,2-d]pyrimidin-4-one (CAS 2253686-94-9) is a chemical compound with the molecular formula C13H15N5OS and a molecular weight of 289.36 g/mol. IUPAC name: 2-[(1S)-1-amino-2-methylpropyl]-6-(1H-pyrazol-5-yl)-3H-thieno[3,2-d]pyrimidin-4-one. InChIKey: BHFYJEOUSGMTBT-JTQLQIEISA-N.
| Molecular formula | C13H15N5OS |
|---|---|
| Molecular weight | 289.36 g/mol |
| IUPAC name | 2-[(1S)-1-amino-2-methylpropyl]-6-(1H-pyrazol-5-yl)-3H-thieno[3,2-d]pyrimidin-4-one |
| InChIKey | BHFYJEOUSGMTBT-JTQLQIEISA-N |
| SMILES | CC(C)[C@@H](C1=NC2=C(C(=O)N1)SC(=C2)C3=CC=NN3)N |
Computed by PubChem (NCBI)
Synonyms:
Cdc7-IN-17, orb1689437