Products 2253996-75-5
CAS 2253996-75-5 is the registry number for Antiparasitic agent-7. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-1-(2-nitrophenyl)prop-2-en-1-ol (CAS 2253996-75-5) is a chemical compound with the molecular formula C18H15N3O5 and a molecular weight of 353.3 g/mol. IUPAC name: 2-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-1-(2-nitrophenyl)prop-2-en-1-ol. InChIKey: WBVYYNPRXBIFTF-UHFFFAOYSA-N.
| Molecular formula | C18H15N3O5 |
|---|---|
| Molecular weight | 353.3 g/mol |
| IUPAC name | 2-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-1-(2-nitrophenyl)prop-2-en-1-ol |
| InChIKey | WBVYYNPRXBIFTF-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=NOC(=N2)C(=C)C(C3=CC=CC=C3[N+](=O)[O-])O |
Computed by PubChem (NCBI)
Synonyms:
Antiparasitic agent-7, orb1688792