Products 22544-42-9

CAS 22544-42-9 is the registry number for Ethyl-1,1-d2 Alcohol-OD, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,5g, 0,25g.

Structural formula: {0} (CAS {1})

1,1-dideuterio-1-deuteriooxyethane (CAS 22544-42-9) is a chemical compound with the molecular formula C2H6O and a molecular weight of 49.09 g/mol. IUPAC name: 1,1-dideuterio-1-deuteriooxyethane. InChIKey: LFQSCWFLJHTTHZ-UHVFUKFASA-N.

Identity
Molecular formulaC2H6O
Molecular weight49.09 g/mol
IUPAC name1,1-dideuterio-1-deuteriooxyethane
InChIKeyLFQSCWFLJHTTHZ-UHVFUKFASA-N
SMILES[2H]C([2H])(C)O[2H]

Computed by PubChem (NCBI)