CAS 2255323-22-7 is the registry number for N-Methyl-O-(2,2,3,3-tetrafluoropropyl)-L-serine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-(methylamino)-3-(2,2,3,3-tetrafluoropropoxy)propanoic acid (CAS 2255323-22-7) is a chemical compound with the molecular formula C7H11F4NO3 and a molecular weight of 233.16 g/mol. IUPAC name: (2S)-2-(methylamino)-3-(2,2,3,3-tetrafluoropropoxy)propanoic acid. InChIKey: JXEBQGSCCKVUQW-BYPYZUCNSA-N.
| Molecular formula | C7H11F4NO3 |
|---|---|
| Molecular weight | 233.16 g/mol |
| IUPAC name | (2S)-2-(methylamino)-3-(2,2,3,3-tetrafluoropropoxy)propanoic acid |
| InChIKey | JXEBQGSCCKVUQW-BYPYZUCNSA-N |
| SMILES | CN[C@@H](COCC(C(F)F)(F)F)C(=O)O |
Computed by PubChem (NCBI)