Products 2255338-25-9
CAS 2255338-25-9 appears in our catalog under these names: SGC-iMLLT, 99+%, SGC-iMLLT, SGC-iMLLT, 99.21% ,, 99.21% ,, SGC-iMLLT, 99.33%. Offered by: AmBeed, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 100mg, 2mg, 25mg, 10mg, 50mg, 25 mg, 10mM/1mL, 100 mg.
1-methyl-N-[2-[[(2S)-2-methylpyrrolidin-1-yl]methyl]-3H-benzimidazol-5-yl]indazole-5-carboxamide (CAS 2255338-25-9) is a chemical compound with the molecular formula C22H24N6O and a molecular weight of 388.5 g/mol. IUPAC name: 1-methyl-N-[2-[[(2S)-2-methylpyrrolidin-1-yl]methyl]-3H-benzimidazol-5-yl]indazole-5-carboxamide. InChIKey: QGNDVASWIHEXCL-AWEZNQCLSA-N.
| Molecular formula | C22H24N6O |
|---|---|
| Molecular weight | 388.5 g/mol |
| IUPAC name | 1-methyl-N-[2-[[(2S)-2-methylpyrrolidin-1-yl]methyl]-3H-benzimidazol-5-yl]indazole-5-carboxamide |
| InChIKey | QGNDVASWIHEXCL-AWEZNQCLSA-N |
| SMILES | C[C@H]1CCCN1CC2=NC3=C(N2)C=C(C=C3)NC(=O)C4=CC5=C(C=C4)N(N=C5)C |
Computed by PubChem (NCBI)