CAS 2256708-79-7 is the registry number for (4–(4–methyl–1H–pyrazol–1–yl)–3–(trifluoromethyl)phenyl)boronic acid. Offered by: GLPBio. Available pack sizes: 10mg, 25mg.
[4-(4-methylpyrazol-1-yl)-3-(trifluoromethyl)phenyl]boronic acid (CAS 2256708-79-7) is a chemical compound with the molecular formula C11H10BF3N2O2 and a molecular weight of 270.02 g/mol. IUPAC name: [4-(4-methylpyrazol-1-yl)-3-(trifluoromethyl)phenyl]boronic acid. InChIKey: PGLRODUQRYTBKX-UHFFFAOYSA-N.
| Molecular formula | C11H10BF3N2O2 |
|---|---|
| Molecular weight | 270.02 g/mol |
| IUPAC name | [4-(4-methylpyrazol-1-yl)-3-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | PGLRODUQRYTBKX-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)N2C=C(C=N2)C)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)