CAS 2256772-30-0 is the registry number for Copper(I) 2-naphthoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Copper(1+);naphthalene-2-carboxylate (CAS 2256772-30-0) is a chemical compound with the molecular formula C11H7CuO2 and a molecular weight of 234.72 g/mol. IUPAC name: copper(1+);naphthalene-2-carboxylate. InChIKey: ONHBGWDHSHAXKI-UHFFFAOYSA-M.
| Molecular formula | C11H7CuO2 |
|---|---|
| Molecular weight | 234.72 g/mol |
| IUPAC name | copper(1+);naphthalene-2-carboxylate |
| InChIKey | ONHBGWDHSHAXKI-UHFFFAOYSA-M |
| SMILES | C1=CC=C2C=C(C=CC2=C1)C(=O)[O-].[Cu+] |
Computed by PubChem (NCBI)