Products 22581-06-2
CAS 22581-06-2 is the registry number for Ilicicolin A. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-chloro-2,4-dihydroxy-6-methyl-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]benzaldehyde (CAS 22581-06-2) is a chemical compound with the molecular formula C23H31ClO3 and a molecular weight of 390.9 g/mol. IUPAC name: 5-chloro-2,4-dihydroxy-6-methyl-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]benzaldehyde. InChIKey: MHWOMRMBQGSTFS-JTCWOHKRSA-N.
| Molecular formula | C23H31ClO3 |
|---|---|
| Molecular weight | 390.9 g/mol |
| IUPAC name | 5-chloro-2,4-dihydroxy-6-methyl-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]benzaldehyde |
| InChIKey | MHWOMRMBQGSTFS-JTCWOHKRSA-N |
| SMILES | CC1=C(C(=C(C(=C1Cl)O)C/C=C(\C)/CC/C=C(\C)/CCC=C(C)C)O)C=O |
Computed by PubChem (NCBI)