CAS 22581-87-9 is the registry number for 4-Isopropyl-pyridine 1-oxide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
1-oxido-4-propan-2-ylpyridin-1-ium (CAS 22581-87-9) is a chemical compound with the molecular formula C8H11NO and a molecular weight of 137.18 g/mol. IUPAC name: 1-oxido-4-propan-2-ylpyridin-1-ium. InChIKey: WHHSRRQBFPSMIO-UHFFFAOYSA-N.
| Molecular formula | C8H11NO |
|---|---|
| Molecular weight | 137.18 g/mol |
| IUPAC name | 1-oxido-4-propan-2-ylpyridin-1-ium |
| InChIKey | WHHSRRQBFPSMIO-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=[N+](C=C1)[O-] |
Computed by PubChem (NCBI)