Products 22583-75-1
CAS 22583-75-1 appears in our catalog under these names: Benzophenone-d10, >95% (HPLC), Benzophenone-d10, 99 atom % D, min 98% Chemical Purity, Benzophenone–d10, BENZOPHENONE-D10, 99 ATOM % D, Benzophenone-d10, 99.63%. Offered by: TRC, CDN, GLPBio, Sigma-Aldrich, MedChemExpress. Available pack sizes: 100mg, 500mg, 50mg, 1g, 5G, 25 mg, 100 mg, 50 mg.
Bis(2,3,4,5,6-pentadeuteriophenyl)methanone (CAS 22583-75-1) is a chemical compound with the molecular formula C13H10O and a molecular weight of 192.28 g/mol. IUPAC name: bis(2,3,4,5,6-pentadeuteriophenyl)methanone. InChIKey: RWCCWEUUXYIKHB-LHNTUAQVSA-N.
| Molecular formula | C13H10O |
|---|---|
| Molecular weight | 192.28 g/mol |
| IUPAC name | bis(2,3,4,5,6-pentadeuteriophenyl)methanone |
| InChIKey | RWCCWEUUXYIKHB-LHNTUAQVSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C(=O)C2=C(C(=C(C(=C2[2H])[2H])[2H])[2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)