Products 2258639-09-5
CAS 2258639-09-5 is the registry number for (S)-(4-bromophenyl)(imino)methyl-lambda6-sulfanone, >97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(4-bromophenyl)-imino-methyl-oxo-lambda6-sulfane (CAS 2258639-09-5) is a chemical compound with the molecular formula C7H8BrNOS and a molecular weight of 234.12 g/mol. IUPAC name: (4-bromophenyl)-imino-methyl-oxo-lambda6-sulfane. InChIKey: VFSHUOASIOCCAA-NSHDSACASA-N.
| Molecular formula | C7H8BrNOS |
|---|---|
| Molecular weight | 234.12 g/mol |
| IUPAC name | (4-bromophenyl)-imino-methyl-oxo-lambda6-sulfane |
| InChIKey | VFSHUOASIOCCAA-NSHDSACASA-N |
| SMILES | C[S@](=N)(=O)C1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)