CAS 225920-04-7 appears in our catalog under these names: (1R)-1-(4-Ethoxyphenyl)ethan-1-ol, 95%, (R)–1–(4–Ethoxyophenyl)ethanol, (R)-1-(4-Ethoxyophenyl)ethanol. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 250mg, 1g, 100mg, 0,5g, 5g.
(1R)-1-(4-ethoxyphenyl)ethanol (CAS 225920-04-7) is a chemical compound with the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. IUPAC name: (1R)-1-(4-ethoxyphenyl)ethanol. InChIKey: GKGQWBJLOYXULB-MRVPVSSYSA-N.
| Molecular formula | C10H14O2 |
|---|---|
| Molecular weight | 166.22 g/mol |
| IUPAC name | (1R)-1-(4-ethoxyphenyl)ethanol |
| InChIKey | GKGQWBJLOYXULB-MRVPVSSYSA-N |
| SMILES | CCOC1=CC=C(C=C1)[C@@H](C)O |
Computed by PubChem (NCBI)