CAS 225920-08-1 is the registry number for (R)-1-(2,6-Dichlorophenyl)ethan-1-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R)-1-(2,6-dichlorophenyl)ethanol (CAS 225920-08-1) is a chemical compound with the molecular formula C8H8Cl2O and a molecular weight of 191.05 g/mol. IUPAC name: (1R)-1-(2,6-dichlorophenyl)ethanol. InChIKey: VUSOJMQVQGKPNN-RXMQYKEDSA-N.
| Molecular formula | C8H8Cl2O |
|---|---|
| Molecular weight | 191.05 g/mol |
| IUPAC name | (1R)-1-(2,6-dichlorophenyl)ethanol |
| InChIKey | VUSOJMQVQGKPNN-RXMQYKEDSA-N |
| SMILES | C[C@H](C1=C(C=CC=C1Cl)Cl)O |
Computed by PubChem (NCBI)