CAS 225927-21-9 appears in our catalog under these names: Polyphenylmethylsiloxane, vinyl terminated, Vinylterminated poly phenyl methylsiloxane. Offered by: GLPBio, Biosynth. Available pack sizes: 100g, 25g, 5g, 10g, 50g.
Bis[[ethenyl(dimethyl)silyl]oxy]-dimethylsilane (CAS 225927-21-9) is a chemical compound with the molecular formula C10H24O2Si3 and a molecular weight of 260.55 g/mol. IUPAC name: bis[[ethenyl(dimethyl)silyl]oxy]-dimethylsilane. InChIKey: MFWYAJVOUCTAQI-UHFFFAOYSA-N.
| Molecular formula | C10H24O2Si3 |
|---|---|
| Molecular weight | 260.55 g/mol |
| IUPAC name | bis[[ethenyl(dimethyl)silyl]oxy]-dimethylsilane |
| InChIKey | MFWYAJVOUCTAQI-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C=C)O[Si](C)(C)O[Si](C)(C)C=C |
Computed by PubChem (NCBI)