Products 2259315-63-2
CAS 2259315-63-2 is the registry number for 2,4-Dichloropyrimidine-d2, 99.32%. Offered by: MedChemExpress. Available pack sizes: 100 mg, 50 mg, 25 mg, 5 mg, 10 mg.
2,4-dichloro-5,6-dideuteriopyrimidine (CAS 2259315-63-2) is a chemical compound with the molecular formula C4H2Cl2N2 and a molecular weight of 150.99 g/mol. IUPAC name: 2,4-dichloro-5,6-dideuteriopyrimidine. InChIKey: BTTNYQZNBZNDOR-QDNHWIQGSA-N.
| Molecular formula | C4H2Cl2N2 |
|---|---|
| Molecular weight | 150.99 g/mol |
| IUPAC name | 2,4-dichloro-5,6-dideuteriopyrimidine |
| InChIKey | BTTNYQZNBZNDOR-QDNHWIQGSA-N |
| SMILES | [2H]C1=C(N=C(N=C1Cl)Cl)[2H] |
Computed by PubChem (NCBI)