CAS 2259674-84-3 appears in our catalog under these names: Sunset Yellow (E110) D4 (phenyl D4), Sunset Yellow (E110) D4 (phenyl D4), >95% (HPLC). Offered by: Dr. Ehrenstorfer, TRC. Available pack sizes: 10mg, 100mg, 50mg.
Disodium;6-hydroxy-5-[(2,3,5,6-tetradeuterio-4-sulfonatophenyl)diazenyl]naphthalene-2-sulfonate (CAS 2259674-84-3) is a chemical compound with the molecular formula C16H10N2Na2O7S2 and a molecular weight of 456.4 g/mol. IUPAC name: disodium;6-hydroxy-5-[(2,3,5,6-tetradeuterio-4-sulfonatophenyl)diazenyl]naphthalene-2-sulfonate. InChIKey: OIQPTROHQCGFEF-KMKMHDSOSA-L.
| Molecular formula | C16H10N2Na2O7S2 |
|---|---|
| Molecular weight | 456.4 g/mol |
| IUPAC name | disodium;6-hydroxy-5-[(2,3,5,6-tetradeuterio-4-sulfonatophenyl)diazenyl]naphthalene-2-sulfonate |
| InChIKey | OIQPTROHQCGFEF-KMKMHDSOSA-L |
| SMILES | [2H]C1=C(C(=C(C(=C1N=NC2=C(C=CC3=C2C=CC(=C3)S(=O)(=O)[O-])O)[2H])[2H])S(=O)(=O)[O-])[2H].[Na+].[Na+] |
Computed by PubChem (NCBI)