CAS 2259710-89-7 is the registry number for DL5055. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-(2,3-dihydro-1H-inden-2-yl)-6-naphthalen-2-ylimidazo[2,1-b][1,3]oxazole-5-carboxamide (CAS 2259710-89-7) is a chemical compound with the molecular formula C25H19N3O2 and a molecular weight of 393.4 g/mol. IUPAC name: N-(2,3-dihydro-1H-inden-2-yl)-6-naphthalen-2-ylimidazo[2,1-b][1,3]oxazole-5-carboxamide. InChIKey: SHTJDFSJXHTSQU-UHFFFAOYSA-N.
| Molecular formula | C25H19N3O2 |
|---|---|
| Molecular weight | 393.4 g/mol |
| IUPAC name | N-(2,3-dihydro-1H-inden-2-yl)-6-naphthalen-2-ylimidazo[2,1-b][1,3]oxazole-5-carboxamide |
| InChIKey | SHTJDFSJXHTSQU-UHFFFAOYSA-N |
| SMILES | C1C(CC2=CC=CC=C21)NC(=O)C3=C(N=C4N3C=CO4)C5=CC6=CC=CC=C6C=C5 |
Computed by PubChem (NCBI)