CAS 2260-08-4 is the registry number for Acetiromate. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-(4-acetyloxy-3-iodophenoxy)-3,5-diiodobenzoic acid (CAS 2260-08-4) is a chemical compound with the molecular formula C15H9I3O5 and a molecular weight of 649.94 g/mol. IUPAC name: 4-(4-acetyloxy-3-iodophenoxy)-3,5-diiodobenzoic acid. InChIKey: AXVCIZJRCOHMQX-UHFFFAOYSA-N.
| Molecular formula | C15H9I3O5 |
|---|---|
| Molecular weight | 649.94 g/mol |
| IUPAC name | 4-(4-acetyloxy-3-iodophenoxy)-3,5-diiodobenzoic acid |
| InChIKey | AXVCIZJRCOHMQX-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=C(C=C(C=C1)OC2=C(C=C(C=C2I)C(=O)O)I)I |
Computed by PubChem (NCBI)